C7H17NO3 — CID 57004338
5-amino-3-(2-hydroxyethyl)pentane-1,4-diol (PubChem CID 57004338) has the molecular formula C7H17NO3 and a molecular weight of 163.22 g/mol. Its IUPAC name is 5-amino-3-(2-hydroxyethyl)pentane-1,4-diol.
| Compound Name | 5-amino-3-(2-hydroxyethyl)pentane-1,4-diol |
|---|---|
| PubChem CID | 57004338 |
| Molecular Formula | C7H17NO3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.12 |
| IUPAC Name | 5-amino-3-(2-hydroxyethyl)pentane-1,4-diol |
| SMILES | NCC(O)C(CCO)CCO |
| InChI | InChI=1S/C7H17NO3/c8-5-7(11)6(1-3-9)2-4-10/h6-7,9-11H,1-5,8H2 |
| InChIKey | JJPWMTDVDQKSBM-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |