C7H9N — CID 57004377
1-cyclopenta-2,4-dien-1-ylethanimine (PubChem CID 57004377) has the molecular formula C7H9N and a molecular weight of 107.16 g/mol. Its IUPAC name is 1-cyclopenta-2,4-dien-1-ylethanimine.
| Compound Name | 1-cyclopenta-2,4-dien-1-ylethanimine |
|---|---|
| PubChem CID | 57004377 |
| Molecular Formula | C7H9N |
| Molecular Weight | 107.16 g/mol |
| Exact Mass | 107.07 |
| IUPAC Name | 1-cyclopenta-2,4-dien-1-ylethanimine |
| SMILES | [H]/N=C(\C)C1C=CC=C1 |
| InChI | InChI=1S/C7H9N/c1-6(8)7-4-2-3-5-7/h2-5,7-8H,1H3/b8-6+ |
| InChIKey | AJOAVZTWMHGXCP-SOFGYWHQSA-N |
| XLogP | 1.77 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 107.16 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|