C16H16F3NO3S — CID 57004725
methyl 3-methoxy-2-[3-[2-methyl-4-(trifluoromethyl)phenyl]-2H-1,3-thiazol-5-yl]prop-2-enoate (PubChem CID 57004725) has the molecular formula C16H16F3NO3S and a molecular weight of 359.37 g/mol. Its IUPAC name is methyl 3-methoxy-2-[3-[2-methyl-4-(trifluoromethyl)phenyl]-2H-1,3-thiazol-5-yl]prop-2-enoate.
| Compound Name | methyl 3-methoxy-2-[3-[2-methyl-4-(trifluoromethyl)phenyl]-2H-1,3-thiazol-5-yl]prop-2-enoate |
|---|---|
| PubChem CID | 57004725 |
| Molecular Formula | C16H16F3NO3S |
| Molecular Weight | 359.37 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | methyl 3-methoxy-2-[3-[2-methyl-4-(trifluoromethyl)phenyl]-2H-1,3-thiazol-5-yl]prop-2-enoate |
| SMILES | COC=C(C(=O)OC)C1=CN(c2ccc(C(F)(F)F)cc2C)CS1 |
| InChI | InChI=1S/C16H16F3NO3S/c1-10-6-11(16(17,18)19)4-5-13(10)20-7-14(24-9-20)12(8-22-2)15(21)23-3/h4-8H,9H2,1-3H3 |
| InChIKey | HLQWBQMQUYDMBW-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.37 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|