C19H22O3S — CID 57006585
(2R,3S,4R,6S)-4-benzyl-2-methyl-6-phenylsulfanyloxane-3,4-diol (PubChem CID 57006585) has the molecular formula C19H22O3S and a molecular weight of 330.45 g/mol. Its IUPAC name is (2R,3S,4R,6S)-4-benzyl-2-methyl-6-phenylsulfanyloxane-3,4-diol.
| Compound Name | (2R,3S,4R,6S)-4-benzyl-2-methyl-6-phenylsulfanyloxane-3,4-diol |
|---|---|
| PubChem CID | 57006585 |
| Molecular Formula | C19H22O3S |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | (2R,3S,4R,6S)-4-benzyl-2-methyl-6-phenylsulfanyloxane-3,4-diol |
| SMILES | C[C@H]1O[C@@H](Sc2ccccc2)C[C@](O)(Cc2ccccc2)[C@H]1O |
| InChI | InChI=1S/C19H22O3S/c1-14-18(20)19(21,12-15-8-4-2-5-9-15)13-17(22-14)23-16-10-6-3-7-11-16/h2-11,14,17-18,20-21H,12-13H2,1H3/t14-,17+,18+,19-/m1/s1 |
| InChIKey | UQGVUMZCRCRUDP-GRGSLBFTSA-N |
| XLogP | 3.25 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |