C29H29NO4S — CID 57008480
methyl 2-[3-[2-(4-benzylphenyl)-1-methylsulfonyl-1-(1H-pyrrol-2-yl)ethyl]phenyl]acetate (PubChem CID 57008480) has the molecular formula C29H29NO4S and a molecular weight of 487.62 g/mol. Its IUPAC name is methyl 2-[3-[2-(4-benzylphenyl)-1-methylsulfonyl-1-(1H-pyrrol-2-yl)ethyl]phenyl]acetate.
| Compound Name | methyl 2-[3-[2-(4-benzylphenyl)-1-methylsulfonyl-1-(1H-pyrrol-2-yl)ethyl]phenyl]acetate |
|---|---|
| PubChem CID | 57008480 |
| Molecular Formula | C29H29NO4S |
| Molecular Weight | 487.62 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | methyl 2-[3-[2-(4-benzylphenyl)-1-methylsulfonyl-1-(1H-pyrrol-2-yl)ethyl]phenyl]acetate |
| SMILES | COC(=O)Cc1cccc(C(Cc2ccc(Cc3ccccc3)cc2)(c2ccc[nH]2)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C29H29NO4S/c1-34-28(31)20-25-10-6-11-26(19-25)29(35(2,32)33,27-12-7-17-30-27)21-24-15-13-23(14-16-24)18-22-8-4-3-5-9-22/h3-17,19,30H,18,20-21H2,1-2H3 |
| InChIKey | SPRYGTQATGBXOM-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 76.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.62 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |