C25H29NO4S — CID 57020137
2-[3-[2-(4-tert-butylphenyl)-1-methylsulfonyl-1-(1H-pyrrol-2-yl)ethyl]phenyl]acetic acid (PubChem CID 57020137) has the molecular formula C25H29NO4S and a molecular weight of 439.58 g/mol. Its IUPAC name is 2-[3-[2-(4-tert-butylphenyl)-1-methylsulfonyl-1-(1H-pyrrol-2-yl)ethyl]phenyl]acetic acid.
| Compound Name | 2-[3-[2-(4-tert-butylphenyl)-1-methylsulfonyl-1-(1H-pyrrol-2-yl)ethyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 57020137 |
| Molecular Formula | C25H29NO4S |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | 2-[3-[2-(4-tert-butylphenyl)-1-methylsulfonyl-1-(1H-pyrrol-2-yl)ethyl]phenyl]acetic acid |
| SMILES | CC(C)(C)c1ccc(CC(c2cccc(CC(=O)O)c2)(c2ccc[nH]2)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C25H29NO4S/c1-24(2,3)20-12-10-18(11-13-20)17-25(31(4,29)30,22-9-6-14-26-22)21-8-5-7-19(15-21)16-23(27)28/h5-15,26H,16-17H2,1-4H3,(H,27,28) |
| InChIKey | XKCFFYQPMVRLER-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 87.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |