C5H9FO2S — CID 57009242
(2S,4S,5S)-4-fluoro-5-(hydroxymethyl)thiolan-2-ol (PubChem CID 57009242) has the molecular formula C5H9FO2S and a molecular weight of 152.19 g/mol. Its IUPAC name is (2S,4S,5S)-4-fluoro-5-(hydroxymethyl)thiolan-2-ol.
| Compound Name | (2S,4S,5S)-4-fluoro-5-(hydroxymethyl)thiolan-2-ol |
|---|---|
| PubChem CID | 57009242 |
| Molecular Formula | C5H9FO2S |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.03 |
| IUPAC Name | (2S,4S,5S)-4-fluoro-5-(hydroxymethyl)thiolan-2-ol |
| SMILES | OC[C@@H]1S[C@H](O)C[C@@H]1F |
| InChI | InChI=1S/C5H9FO2S/c6-3-1-5(8)9-4(3)2-7/h3-5,7-8H,1-2H2/t3-,4-,5-/m0/s1 |
| InChIKey | XPDFMQZQFLMPAE-YUPRTTJUSA-N |
| XLogP | 0.14 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |