C17H17IN2O5 — CID 57009455
[5-iodo-3-(phenylmethoxycarbonylamino)-3,4-dihydropyridin-2-yl] 2-oxobutanoate (PubChem CID 57009455) has the molecular formula C17H17IN2O5 and a molecular weight of 456.24 g/mol. Its IUPAC name is [5-iodo-3-(phenylmethoxycarbonylamino)-3,4-dihydropyridin-2-yl] 2-oxobutanoate.
| Compound Name | [5-iodo-3-(phenylmethoxycarbonylamino)-3,4-dihydropyridin-2-yl] 2-oxobutanoate |
|---|---|
| PubChem CID | 57009455 |
| Molecular Formula | C17H17IN2O5 |
| Molecular Weight | 456.24 g/mol |
| Exact Mass | 456.02 |
| IUPAC Name | [5-iodo-3-(phenylmethoxycarbonylamino)-3,4-dihydropyridin-2-yl] 2-oxobutanoate |
| SMILES | CCC(=O)C(=O)OC1=NC=C(I)CC1NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H17IN2O5/c1-2-14(21)16(22)25-15-13(8-12(18)9-19-15)20-17(23)24-10-11-6-4-3-5-7-11/h3-7,9,13H,2,8,10H2,1H3,(H,20,23) |
| InChIKey | MOXPTZNPRRVEMR-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.24 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|