4-amino-2,5-dimethylhex-2-enoic acid

C8H15NO2 — CID 57009858

IUPAC4-amino-2,5-dimethylhex-2-enoic acid
SMILESCC(=CC(N)C(C)C)C(=O)O
InChIInChI=1S/C8H15NO2/c1-5(2)7(9)4-6(3)8(10)11/h4-5,7H,9H2,1-3H3,(H,10,11)
InChIKeySBJZXWKYPGOLEN-UHFFFAOYSA-N
MW157.21 g/mol
LogP1.00
Rot. Bonds3

About 4-amino-2,5-dimethylhex-2-enoic acid

4-amino-2,5-dimethylhex-2-enoic acid (PubChem CID 57009858) has the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. Its IUPAC name is 4-amino-2,5-dimethylhex-2-enoic acid.

Molecular Properties

Compound Name4-amino-2,5-dimethylhex-2-enoic acid
PubChem CID57009858
Molecular FormulaC8H15NO2
Molecular Weight157.21 g/mol
Exact Mass157.11
IUPAC Name4-amino-2,5-dimethylhex-2-enoic acid
SMILESCC(=CC(N)C(C)C)C(=O)O
InChIInChI=1S/C8H15NO2/c1-5(2)7(9)4-6(3)8(10)11/h4-5,7H,9H2,1-3H3,(H,10,11)
InChIKeySBJZXWKYPGOLEN-UHFFFAOYSA-N
XLogP1.00
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500157.21
LogP ≤ 51.00
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 4-amino-2,5-dimethylhex-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-amino-2,5-dimethylhex-2-enoic acid?
The IUPAC name of 4-amino-2,5-dimethylhex-2-enoic acid (CID 57009858) is 4-amino-2,5-dimethylhex-2-enoic acid.
What is the SMILES notation for 4-amino-2,5-dimethylhex-2-enoic acid?
The canonical SMILES for 4-amino-2,5-dimethylhex-2-enoic acid is CC(=CC(N)C(C)C)C(=O)O.
What is the InChIKey of 4-amino-2,5-dimethylhex-2-enoic acid?
The InChIKey is SBJZXWKYPGOLEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO2/c1-5(2)7(9)4-6(3)8(10)11/h4-5,7H,9H2,1-3H3,(H,10,11).
What are the key properties of 4-amino-2,5-dimethylhex-2-enoic acid?
4-amino-2,5-dimethylhex-2-enoic acid has a molecular weight of 157.21 g/mol, XLogP of 1.00, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2,5-dimethylhex-2-enoic acid is sourced from PubChem (CID 57009858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).