C8H15NO2 — CID 57009858
4-amino-2,5-dimethylhex-2-enoic acid (PubChem CID 57009858) has the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. Its IUPAC name is 4-amino-2,5-dimethylhex-2-enoic acid.
| Compound Name | 4-amino-2,5-dimethylhex-2-enoic acid |
|---|---|
| PubChem CID | 57009858 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | 4-amino-2,5-dimethylhex-2-enoic acid |
| SMILES | CC(=CC(N)C(C)C)C(=O)O |
| InChI | InChI=1S/C8H15NO2/c1-5(2)7(9)4-6(3)8(10)11/h4-5,7H,9H2,1-3H3,(H,10,11) |
| InChIKey | SBJZXWKYPGOLEN-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|