C20H18O4S — CID 57011187
methyl 4-[2-(3,4-dimethoxyphenyl)ethenyl]-1-benzothiophene-2-carboxylate (PubChem CID 57011187) has the molecular formula C20H18O4S and a molecular weight of 354.43 g/mol. Its IUPAC name is methyl 4-[2-(3,4-dimethoxyphenyl)ethenyl]-1-benzothiophene-2-carboxylate.
| Compound Name | methyl 4-[2-(3,4-dimethoxyphenyl)ethenyl]-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 57011187 |
| Molecular Formula | C20H18O4S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | methyl 4-[2-(3,4-dimethoxyphenyl)ethenyl]-1-benzothiophene-2-carboxylate |
| SMILES | COC(=O)c1cc2c(C=Cc3ccc(OC)c(OC)c3)cccc2s1 |
| InChI | InChI=1S/C20H18O4S/c1-22-16-10-8-13(11-17(16)23-2)7-9-14-5-4-6-18-15(14)12-19(25-18)20(21)24-3/h4-12H,1-3H3 |
| InChIKey | LIAZUFGQHWBTKQ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|