C45H52N12O4 — CID 57011269
ethyl 4-[[4-(diethylamino)-6-[4-[[4-[[4-(diethylamino)-6-(4-ethoxycarbonylanilino)-1,3,5-triazin-2-yl]amino]phenyl]methyl]anilino]-1,3,5-triazin-2-yl]amino]benzoate (PubChem CID 57011269) has the molecular formula C45H52N12O4 and a molecular weight of 824.99 g/mol. Its IUPAC name is ethyl 4-[[4-(diethylamino)-6-[4-[[4-[[4-(diethylamino)-6-(4-ethoxycarbonylanilino)-1,3,5-triazin-2-yl]amino]phenyl]methyl]anilino]-1,3,5-triazin-2-yl]amino]benzoate.
| Compound Name | ethyl 4-[[4-(diethylamino)-6-[4-[[4-[[4-(diethylamino)-6-(4-ethoxycarbonylanilino)-1,3,5-triazin-2-yl]amino]phenyl]methyl]anilino]-1,3,5-triazin-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 57011269 |
| Molecular Formula | C45H52N12O4 |
| Molecular Weight | 824.99 g/mol |
| Exact Mass | 824.42 |
| IUPAC Name | ethyl 4-[[4-(diethylamino)-6-[4-[[4-[[4-(diethylamino)-6-(4-ethoxycarbonylanilino)-1,3,5-triazin-2-yl]amino]phenyl]methyl]anilino]-1,3,5-triazin-2-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(Nc2nc(Nc3ccc(Cc4ccc(Nc5nc(Nc6ccc(C(=O)OCC)cc6)nc(N(CC)CC)n5)cc4)cc3)nc(N(CC)CC)n2)cc1 |
| InChI | InChI=1S/C45H52N12O4/c1-7-56(8-2)44-52-40(50-42(54-44)48-36-25-17-32(18-26-36)38(58)60-11-5)46-34-21-13-30(14-22-34)29-31-15-23-35(24-16-31)47-41-51-43(55-45(53-41)57(9-3)10-4)49-37-27-19-33(20-28-37)39(59)61-12-6/h13-28H,7-12,29H2,1-6H3,(H2,46,48,50,52,54)(H2,47,49,51,53,55) |
| InChIKey | LSHLYXPKMCBQQD-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 184.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.99 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |