C20H26N6O2 — CID 3428209
4-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]amino]benzoic acid (PubChem CID 3428209) has the molecular formula C20H26N6O2 and a molecular weight of 382.47 g/mol. Its IUPAC name is 4-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]amino]benzoic acid.
| Compound Name | 4-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 3428209 |
| Molecular Formula | C20H26N6O2 |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | 4-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]amino]benzoic acid |
| SMILES | O=C(O)c1ccc(Nc2nc(N3CCCCC3)nc(N3CCCCC3)n2)cc1 |
| InChI | InChI=1S/C20H26N6O2/c27-17(28)15-7-9-16(10-8-15)21-18-22-19(25-11-3-1-4-12-25)24-20(23-18)26-13-5-2-6-14-26/h7-10H,1-6,11-14H2,(H,27,28)(H,21,22,23,24) |
| InChIKey | BSROMFKSIHBJEK-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |