C22H20N2O5S — CID 57011274
1-[(2S,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(9H-fluoren-9-yl)-4-sulfanylidenepyrimidin-2-one (PubChem CID 57011274) has the molecular formula C22H20N2O5S and a molecular weight of 424.48 g/mol. Its IUPAC name is 1-[(2S,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(9H-fluoren-9-yl)-4-sulfanylidenepyrimidin-2-one.
| Compound Name | 1-[(2S,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(9H-fluoren-9-yl)-4-sulfanylidenepyrimidin-2-one |
|---|---|
| PubChem CID | 57011274 |
| Molecular Formula | C22H20N2O5S |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | 1-[(2S,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(9H-fluoren-9-yl)-4-sulfanylidenepyrimidin-2-one |
| SMILES | O=c1[nH]c(=S)c(C2c3ccccc3-c3ccccc32)cn1[C@H]1O[C@@H](CO)C(O)C1O |
| InChI | InChI=1S/C22H20N2O5S/c25-10-16-18(26)19(27)21(29-16)24-9-15(20(30)23-22(24)28)17-13-7-3-1-5-11(13)12-6-2-4-8-14(12)17/h1-9,16-19,21,25-27H,10H2,(H,23,28,30)/t16-,18?,19?,21-/m0/s1 |
| InChIKey | YUWIGBFQEACJOB-IDVGRALLSA-N |
| XLogP | 1.68 |
| TPSA | 107.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|