C17H16N2O3 — CID 57014850
6-[2-(cyclohex-3-ene-1-carbonyl)pyrrol-2-yl]pyridine-3-carboxylic acid (PubChem CID 57014850) has the molecular formula C17H16N2O3 and a molecular weight of 296.33 g/mol. Its IUPAC name is 6-[2-(cyclohex-3-ene-1-carbonyl)pyrrol-2-yl]pyridine-3-carboxylic acid.
| Compound Name | 6-[2-(cyclohex-3-ene-1-carbonyl)pyrrol-2-yl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 57014850 |
| Molecular Formula | C17H16N2O3 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 6-[2-(cyclohex-3-ene-1-carbonyl)pyrrol-2-yl]pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1ccc(C2(C(=O)C3CC=CCC3)C=CC=N2)nc1 |
| InChI | InChI=1S/C17H16N2O3/c20-15(12-5-2-1-3-6-12)17(9-4-10-19-17)14-8-7-13(11-18-14)16(21)22/h1-2,4,7-12H,3,5-6H2,(H,21,22) |
| InChIKey | DGBMDYBUTSXQKV-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|