C23H33NO2 — CID 57014973
methyl 2-[1-(4-cyclohexyl-4-phenylbut-3-enyl)pyrrolidin-3-yl]acetate (PubChem CID 57014973) has the molecular formula C23H33NO2 and a molecular weight of 355.52 g/mol. Its IUPAC name is methyl 2-[1-(4-cyclohexyl-4-phenylbut-3-enyl)pyrrolidin-3-yl]acetate.
| Compound Name | methyl 2-[1-(4-cyclohexyl-4-phenylbut-3-enyl)pyrrolidin-3-yl]acetate |
|---|---|
| PubChem CID | 57014973 |
| Molecular Formula | C23H33NO2 |
| Molecular Weight | 355.52 g/mol |
| Exact Mass | 355.25 |
| IUPAC Name | methyl 2-[1-(4-cyclohexyl-4-phenylbut-3-enyl)pyrrolidin-3-yl]acetate |
| SMILES | COC(=O)CC1CCN(CCC=C(c2ccccc2)C2CCCCC2)C1 |
| InChI | InChI=1S/C23H33NO2/c1-26-23(25)17-19-14-16-24(18-19)15-8-13-22(20-9-4-2-5-10-20)21-11-6-3-7-12-21/h2,4-5,9-10,13,19,21H,3,6-8,11-12,14-18H2,1H3 |
| InChIKey | VGLCFFSIZMKPTG-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.52 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |