C17H27ClN2O2S — CID 57015700
N-[2-(3-chloro-4-piperidin-1-ylphenyl)propyl]propane-2-sulfonamide (PubChem CID 57015700) has the molecular formula C17H27ClN2O2S and a molecular weight of 358.94 g/mol. Its IUPAC name is N-[2-(3-chloro-4-piperidin-1-ylphenyl)propyl]propane-2-sulfonamide.
| Compound Name | N-[2-(3-chloro-4-piperidin-1-ylphenyl)propyl]propane-2-sulfonamide |
|---|---|
| PubChem CID | 57015700 |
| Molecular Formula | C17H27ClN2O2S |
| Molecular Weight | 358.94 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | N-[2-(3-chloro-4-piperidin-1-ylphenyl)propyl]propane-2-sulfonamide |
| SMILES | CC(CNS(=O)(=O)C(C)C)c1ccc(N2CCCCC2)c(Cl)c1 |
| InChI | InChI=1S/C17H27ClN2O2S/c1-13(2)23(21,22)19-12-14(3)15-7-8-17(16(18)11-15)20-9-5-4-6-10-20/h7-8,11,13-14,19H,4-6,9-10,12H2,1-3H3 |
| InChIKey | UXNKIDIVJINLID-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.94 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |