C22H29F4NO3S — CID 57017235
methyl (4S)-4-(dec-3-enoylamino)-5-(2,3,5,6-tetrafluorophenyl)sulfanylpentanoate (PubChem CID 57017235) has the molecular formula C22H29F4NO3S and a molecular weight of 463.54 g/mol. Its IUPAC name is methyl (4S)-4-(dec-3-enoylamino)-5-(2,3,5,6-tetrafluorophenyl)sulfanylpentanoate.
| Compound Name | methyl (4S)-4-(dec-3-enoylamino)-5-(2,3,5,6-tetrafluorophenyl)sulfanylpentanoate |
|---|---|
| PubChem CID | 57017235 |
| Molecular Formula | C22H29F4NO3S |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | methyl (4S)-4-(dec-3-enoylamino)-5-(2,3,5,6-tetrafluorophenyl)sulfanylpentanoate |
| SMILES | CCCCCCC=CCC(=O)N[C@@H](CCC(=O)OC)CSc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C22H29F4NO3S/c1-3-4-5-6-7-8-9-10-18(28)27-15(11-12-19(29)30-2)14-31-22-20(25)16(23)13-17(24)21(22)26/h8-9,13,15H,3-7,10-12,14H2,1-2H3,(H,27,28)/t15-/m0/s1 |
| InChIKey | XFIVQJCHKLWQCY-HNNXBMFYSA-N |
| XLogP | 5.69 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|