C25H33NO3S — CID 10432691
(4R)-4-[[(E)-dec-3-enoyl]amino]-5-naphthalen-2-ylsulfanylpentanoic acid (PubChem CID 10432691) has the molecular formula C25H33NO3S and a molecular weight of 427.61 g/mol. Its IUPAC name is (4R)-4-[[(E)-dec-3-enoyl]amino]-5-naphthalen-2-ylsulfanylpentanoic acid.
| Compound Name | (4R)-4-[[(E)-dec-3-enoyl]amino]-5-naphthalen-2-ylsulfanylpentanoic acid |
|---|---|
| PubChem CID | 10432691 |
| Molecular Formula | C25H33NO3S |
| Molecular Weight | 427.61 g/mol |
| Exact Mass | 427.22 |
| IUPAC Name | (4R)-4-[[(E)-dec-3-enoyl]amino]-5-naphthalen-2-ylsulfanylpentanoic acid |
| SMILES | CCCCCC/C=C/CC(=O)N[C@H](CCC(=O)O)CSc1ccc2ccccc2c1 |
| InChI | InChI=1S/C25H33NO3S/c1-2-3-4-5-6-7-8-13-24(27)26-22(15-17-25(28)29)19-30-23-16-14-20-11-9-10-12-21(20)18-23/h7-12,14,16,18,22H,2-6,13,15,17,19H2,1H3,(H,26,27)(H,28,29)/b8-7+/t22-/m1/s1 |
| InChIKey | PLKZQOUEMBHADV-VQKOGROQSA-N |
| XLogP | 6.20 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.61 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|