C28H39NO3S — CID 67898097
(4S)-4-(7-ethylnonanoylamino)-5-(3-phenylphenyl)sulfanylpentanoic acid (PubChem CID 67898097) has the molecular formula C28H39NO3S and a molecular weight of 469.69 g/mol. Its IUPAC name is (4S)-4-(7-ethylnonanoylamino)-5-(3-phenylphenyl)sulfanylpentanoic acid.
| Compound Name | (4S)-4-(7-ethylnonanoylamino)-5-(3-phenylphenyl)sulfanylpentanoic acid |
|---|---|
| PubChem CID | 67898097 |
| Molecular Formula | C28H39NO3S |
| Molecular Weight | 469.69 g/mol |
| Exact Mass | 469.27 |
| IUPAC Name | (4S)-4-(7-ethylnonanoylamino)-5-(3-phenylphenyl)sulfanylpentanoic acid |
| SMILES | CCC(CC)CCCCCC(=O)N[C@@H](CCC(=O)O)CSc1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C28H39NO3S/c1-3-22(4-2)12-7-5-10-17-27(30)29-25(18-19-28(31)32)21-33-26-16-11-15-24(20-26)23-13-8-6-9-14-23/h6,8-9,11,13-16,20,22,25H,3-5,7,10,12,17-19,21H2,1-2H3,(H,29,30)(H,31,32)/t25-/m0/s1 |
| InChIKey | KAFFBEMNVOAZNP-VWLOTQADSA-N |
| XLogP | 7.18 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.69 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|