C24H31NO3S — CID 54089871
(3S)-3-(octanoylamino)-4-(4-phenylphenyl)sulfanylbutanoic acid (PubChem CID 54089871) has the molecular formula C24H31NO3S and a molecular weight of 413.58 g/mol. Its IUPAC name is (3S)-3-(octanoylamino)-4-(4-phenylphenyl)sulfanylbutanoic acid.
| Compound Name | (3S)-3-(octanoylamino)-4-(4-phenylphenyl)sulfanylbutanoic acid |
|---|---|
| PubChem CID | 54089871 |
| Molecular Formula | C24H31NO3S |
| Molecular Weight | 413.58 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | (3S)-3-(octanoylamino)-4-(4-phenylphenyl)sulfanylbutanoic acid |
| SMILES | CCCCCCCC(=O)N[C@H](CSc1ccc(-c2ccccc2)cc1)CC(=O)O |
| InChI | InChI=1S/C24H31NO3S/c1-2-3-4-5-9-12-23(26)25-21(17-24(27)28)18-29-22-15-13-20(14-16-22)19-10-7-6-8-11-19/h6-8,10-11,13-16,21H,2-5,9,12,17-18H2,1H3,(H,25,26)(H,27,28)/t21-/m0/s1 |
| InChIKey | MTBZQZIXZXIQJC-NRFANRHFSA-N |
| XLogP | 5.77 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.58 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|