C20H30N2O4 — CID 127048894
(4R)-4-[(6-anilino-6-oxohexanoyl)amino]octanoic acid (PubChem CID 127048894) has the molecular formula C20H30N2O4 and a molecular weight of 362.47 g/mol. Its IUPAC name is (4R)-4-[(6-anilino-6-oxohexanoyl)amino]octanoic acid.
| Compound Name | (4R)-4-[(6-anilino-6-oxohexanoyl)amino]octanoic acid |
|---|---|
| PubChem CID | 127048894 |
| Molecular Formula | C20H30N2O4 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | (4R)-4-[(6-anilino-6-oxohexanoyl)amino]octanoic acid |
| SMILES | CCCC[C@H](CCC(=O)O)NC(=O)CCCCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C20H30N2O4/c1-2-3-9-17(14-15-20(25)26)22-19(24)13-8-7-12-18(23)21-16-10-5-4-6-11-16/h4-6,10-11,17H,2-3,7-9,12-15H2,1H3,(H,21,23)(H,22,24)(H,25,26)/t17-/m1/s1 |
| InChIKey | CAHYHNACHHQHPG-QGZVFWFLSA-N |
| XLogP | 3.73 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|