C35H63N3O3 — CID 67662499
N-(1-anilino-1-oxononan-3-yl)-11-hydroxy-12-(octylamino)dodecanamide (PubChem CID 67662499) has the molecular formula C35H63N3O3 and a molecular weight of 573.91 g/mol. Its IUPAC name is N-(1-anilino-1-oxononan-3-yl)-11-hydroxy-12-(octylamino)dodecanamide.
| Compound Name | N-(1-anilino-1-oxononan-3-yl)-11-hydroxy-12-(octylamino)dodecanamide |
|---|---|
| PubChem CID | 67662499 |
| Molecular Formula | C35H63N3O3 |
| Molecular Weight | 573.91 g/mol |
| Exact Mass | 573.49 |
| IUPAC Name | N-(1-anilino-1-oxononan-3-yl)-11-hydroxy-12-(octylamino)dodecanamide |
| SMILES | CCCCCCCCNCC(O)CCCCCCCCCC(=O)NC(CCCCCC)CC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C35H63N3O3/c1-3-5-7-9-15-22-28-36-30-33(39)26-20-13-11-10-12-14-21-27-34(40)38-32(25-17-8-6-4-2)29-35(41)37-31-23-18-16-19-24-31/h16,18-19,23-24,32-33,36,39H,3-15,17,20-22,25-30H2,1-2H3,(H,37,41)(H,38,40) |
| InChIKey | YLQJGQDICKFWFI-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.91 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|