C19H24N2 — CID 57017526
6-(cyclopropylmethyl)-4-methyl-5,11-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-1,4,9(16),11-tetraene (PubChem CID 57017526) has the molecular formula C19H24N2 and a molecular weight of 280.41 g/mol. Its IUPAC name is 6-(cyclopropylmethyl)-4-methyl-5,11-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-1,4,9(16),11-tetraene.
| Compound Name | 6-(cyclopropylmethyl)-4-methyl-5,11-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-1,4,9(16),11-tetraene |
|---|---|
| PubChem CID | 57017526 |
| Molecular Formula | C19H24N2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | 6-(cyclopropylmethyl)-4-methyl-5,11-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-1,4,9(16),11-tetraene |
| SMILES | CC1=NC(CC2CC2)C2CC3=C4C(=NC3)CCCC4=C2C1 |
| InChI | InChI=1S/C19H24N2/c1-11-7-15-14-3-2-4-17-19(14)13(10-20-17)9-16(15)18(21-11)8-12-5-6-12/h12,16,18H,2-10H2,1H3 |
| InChIKey | MXYYMUIASORTJA-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |