C15H30O7 — CID 57018325
4,4-diethoxy-5,5,7,7-tetramethoxyheptan-2-one (PubChem CID 57018325) has the molecular formula C15H30O7 and a molecular weight of 322.40 g/mol. Its IUPAC name is 4,4-diethoxy-5,5,7,7-tetramethoxyheptan-2-one.
| Compound Name | 4,4-diethoxy-5,5,7,7-tetramethoxyheptan-2-one |
|---|---|
| PubChem CID | 57018325 |
| Molecular Formula | C15H30O7 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | 4,4-diethoxy-5,5,7,7-tetramethoxyheptan-2-one |
| SMILES | CCOC(CC(C)=O)(OCC)C(CC(OC)OC)(OC)OC |
| InChI | InChI=1S/C15H30O7/c1-8-21-15(22-9-2,10-12(3)16)14(19-6,20-7)11-13(17-4)18-5/h13H,8-11H2,1-7H3 |
| InChIKey | BRKVEYQNHFBDLF-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|