C23H21F3N2O6 — CID 57019043
2-[N-[2-(1,3-dioxoisoindol-2-yl)acetyl]-2-(trifluoromethoxy)anilino]-3,3-dimethylbutanoic acid (PubChem CID 57019043) has the molecular formula C23H21F3N2O6 and a molecular weight of 478.42 g/mol. Its IUPAC name is 2-[N-[2-(1,3-dioxoisoindol-2-yl)acetyl]-2-(trifluoromethoxy)anilino]-3,3-dimethylbutanoic acid.
| Compound Name | 2-[N-[2-(1,3-dioxoisoindol-2-yl)acetyl]-2-(trifluoromethoxy)anilino]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 57019043 |
| Molecular Formula | C23H21F3N2O6 |
| Molecular Weight | 478.42 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | 2-[N-[2-(1,3-dioxoisoindol-2-yl)acetyl]-2-(trifluoromethoxy)anilino]-3,3-dimethylbutanoic acid |
| SMILES | CC(C)(C)C(C(=O)O)N(C(=O)CN1C(=O)c2ccccc2C1=O)c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C23H21F3N2O6/c1-22(2,3)18(21(32)33)28(15-10-6-7-11-16(15)34-23(24,25)26)17(29)12-27-19(30)13-8-4-5-9-14(13)20(27)31/h4-11,18H,12H2,1-3H3,(H,32,33) |
| InChIKey | WZVWROYOKRADCI-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.42 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|