C17H23Cl3N2O3S2 — CID 57020698
2,2,2-trichloroethyl N-[(2R)-1-[4-[1-[[2,2-bis(sulfanyl)acetyl]amino]ethyl]phenyl]propan-2-yl]-N-methylcarbamate (PubChem CID 57020698) has the molecular formula C17H23Cl3N2O3S2 and a molecular weight of 473.88 g/mol. Its IUPAC name is 2,2,2-trichloroethyl N-[(2R)-1-[4-[1-[[2,2-bis(sulfanyl)acetyl]amino]ethyl]phenyl]propan-2-yl]-N-methylcarbamate.
| Compound Name | 2,2,2-trichloroethyl N-[(2R)-1-[4-[1-[[2,2-bis(sulfanyl)acetyl]amino]ethyl]phenyl]propan-2-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 57020698 |
| Molecular Formula | C17H23Cl3N2O3S2 |
| Molecular Weight | 473.88 g/mol |
| Exact Mass | 472.02 |
| IUPAC Name | 2,2,2-trichloroethyl N-[(2R)-1-[4-[1-[[2,2-bis(sulfanyl)acetyl]amino]ethyl]phenyl]propan-2-yl]-N-methylcarbamate |
| SMILES | CC(NC(=O)C(S)S)c1ccc(C[C@@H](C)N(C)C(=O)OCC(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C17H23Cl3N2O3S2/c1-10(22(3)16(24)25-9-17(18,19)20)8-12-4-6-13(7-5-12)11(2)21-14(23)15(26)27/h4-7,10-11,15,26-27H,8-9H2,1-3H3,(H,21,23)/t10-,11?/m1/s1 |
| InChIKey | BBMNVDXCPISBLG-NFJWQWPMSA-N |
| XLogP | 4.42 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.88 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|