C26H35N3O3 — CID 57020810
1-[(3aS,3bS,9aR,9bR,11aS)-9a,11a-dimethyl-7-oxo-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-f]quinolin-4-yl]-3-(3-methoxyphenyl)urea (PubChem CID 57020810) has the molecular formula C26H35N3O3 and a molecular weight of 437.58 g/mol. Its IUPAC name is 1-[(3aS,3bS,9aR,9bR,11aS)-9a,11a-dimethyl-7-oxo-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-f]quinolin-4-yl]-3-(3-methoxyphenyl)urea.
| Compound Name | 1-[(3aS,3bS,9aR,9bR,11aS)-9a,11a-dimethyl-7-oxo-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-f]quinolin-4-yl]-3-(3-methoxyphenyl)urea |
|---|---|
| PubChem CID | 57020810 |
| Molecular Formula | C26H35N3O3 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.27 |
| IUPAC Name | 1-[(3aS,3bS,9aR,9bR,11aS)-9a,11a-dimethyl-7-oxo-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-f]quinolin-4-yl]-3-(3-methoxyphenyl)urea |
| SMILES | COc1cccc(NC(=O)NC2CC3NC(=O)C=C[C@]3(C)[C@@H]3CC[C@]4(C)CCC[C@H]4[C@H]23)c1 |
| InChI | InChI=1S/C26H35N3O3/c1-25-11-5-8-18(25)23-19(9-12-25)26(2)13-10-22(30)29-21(26)15-20(23)28-24(31)27-16-6-4-7-17(14-16)32-3/h4,6-7,10,13-14,18-21,23H,5,8-9,11-12,15H2,1-3H3,(H,29,30)(H2,27,28,31)/t18-,19+,20?,21?,23-,25-,26+/m0/s1 |
| InChIKey | CUBSSNKAQZWQNT-JMODJALCSA-N |
| XLogP | 4.48 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |