C16H24N2O3S — CID 59041101
1-(3-methoxyphenyl)-3-[(1R,2R)-2-(sulfanylmethoxymethyl)cyclohexyl]urea (PubChem CID 59041101) has the molecular formula C16H24N2O3S and a molecular weight of 324.45 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-3-[(1R,2R)-2-(sulfanylmethoxymethyl)cyclohexyl]urea.
| Compound Name | 1-(3-methoxyphenyl)-3-[(1R,2R)-2-(sulfanylmethoxymethyl)cyclohexyl]urea |
|---|---|
| PubChem CID | 59041101 |
| Molecular Formula | C16H24N2O3S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 1-(3-methoxyphenyl)-3-[(1R,2R)-2-(sulfanylmethoxymethyl)cyclohexyl]urea |
| SMILES | COc1cccc(NC(=O)N[C@@H]2CCCC[C@H]2COCS)c1 |
| InChI | InChI=1S/C16H24N2O3S/c1-20-14-7-4-6-13(9-14)17-16(19)18-15-8-3-2-5-12(15)10-21-11-22/h4,6-7,9,12,15,22H,2-3,5,8,10-11H2,1H3,(H2,17,18,19)/t12-,15+/m0/s1 |
| InChIKey | IEQZYRVNWNGCHR-SWLSCSKDSA-N |
| XLogP | 3.28 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|