C21H34N2O7 — CID 57021540
1-O-tert-butyl 5-O-(2,5-dihydroxypyrrol-1-yl) (2S)-2-(octanoylamino)pentanedioate (PubChem CID 57021540) has the molecular formula C21H34N2O7 and a molecular weight of 426.51 g/mol. Its IUPAC name is 1-O-tert-butyl 5-O-(2,5-dihydroxypyrrol-1-yl) (2S)-2-(octanoylamino)pentanedioate.
| Compound Name | 1-O-tert-butyl 5-O-(2,5-dihydroxypyrrol-1-yl) (2S)-2-(octanoylamino)pentanedioate |
|---|---|
| PubChem CID | 57021540 |
| Molecular Formula | C21H34N2O7 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | 1-O-tert-butyl 5-O-(2,5-dihydroxypyrrol-1-yl) (2S)-2-(octanoylamino)pentanedioate |
| SMILES | CCCCCCCC(=O)N[C@@H](CCC(=O)On1c(O)ccc1O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H34N2O7/c1-5-6-7-8-9-10-16(24)22-15(20(28)29-21(2,3)4)11-14-19(27)30-23-17(25)12-13-18(23)26/h12-13,15,25-26H,5-11,14H2,1-4H3,(H,22,24)/t15-/m0/s1 |
| InChIKey | PMXOYELLMXDAHA-HNNXBMFYSA-N |
| XLogP | 2.82 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|