C17H27NO5S — CID 57022425
tert-butyl N-[2-(4-hydroxyphenyl)propyl]-N-propan-2-ylsulfonylcarbamate (PubChem CID 57022425) has the molecular formula C17H27NO5S and a molecular weight of 357.47 g/mol. Its IUPAC name is tert-butyl N-[2-(4-hydroxyphenyl)propyl]-N-propan-2-ylsulfonylcarbamate.
| Compound Name | tert-butyl N-[2-(4-hydroxyphenyl)propyl]-N-propan-2-ylsulfonylcarbamate |
|---|---|
| PubChem CID | 57022425 |
| Molecular Formula | C17H27NO5S |
| Molecular Weight | 357.47 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | tert-butyl N-[2-(4-hydroxyphenyl)propyl]-N-propan-2-ylsulfonylcarbamate |
| SMILES | CC(CN(C(=O)OC(C)(C)C)S(=O)(=O)C(C)C)c1ccc(O)cc1 |
| InChI | InChI=1S/C17H27NO5S/c1-12(2)24(21,22)18(16(20)23-17(4,5)6)11-13(3)14-7-9-15(19)10-8-14/h7-10,12-13,19H,11H2,1-6H3 |
| InChIKey | CCCVPWSFZMXPSS-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.47 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |