C17H29NO2 — CID 57028260
methyl 7-[(1S,2S,5R)-2-amino-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]hept-5-enoate (PubChem CID 57028260) has the molecular formula C17H29NO2 and a molecular weight of 279.42 g/mol. Its IUPAC name is methyl 7-[(1S,2S,5R)-2-amino-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]hept-5-enoate.
| Compound Name | methyl 7-[(1S,2S,5R)-2-amino-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]hept-5-enoate |
|---|---|
| PubChem CID | 57028260 |
| Molecular Formula | C17H29NO2 |
| Molecular Weight | 279.42 g/mol |
| Exact Mass | 279.22 |
| IUPAC Name | methyl 7-[(1S,2S,5R)-2-amino-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]hept-5-enoate |
| SMILES | COC(=O)CCCC=CC[C@@]1(N)CC[C@@H]2C[C@H]1C2(C)C |
| InChI | InChI=1S/C17H29NO2/c1-16(2)13-9-11-17(18,14(16)12-13)10-7-5-4-6-8-15(19)20-3/h5,7,13-14H,4,6,8-12,18H2,1-3H3/t13-,14+,17-/m1/s1 |
| InChIKey | DYFZDDOXCMWIOS-JKIFEVAISA-N |
| XLogP | 3.43 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.42 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|