C17H29NO5 — CID 66993929
(2R)-2-tert-butyl-3-hydroxy-2-(7-methoxy-7-oxohept-2-enyl)pyrrolidine-1-carboxylic acid (PubChem CID 66993929) has the molecular formula C17H29NO5 and a molecular weight of 327.42 g/mol. Its IUPAC name is (2R)-2-tert-butyl-3-hydroxy-2-(7-methoxy-7-oxohept-2-enyl)pyrrolidine-1-carboxylic acid.
| Compound Name | (2R)-2-tert-butyl-3-hydroxy-2-(7-methoxy-7-oxohept-2-enyl)pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 66993929 |
| Molecular Formula | C17H29NO5 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.20 |
| IUPAC Name | (2R)-2-tert-butyl-3-hydroxy-2-(7-methoxy-7-oxohept-2-enyl)pyrrolidine-1-carboxylic acid |
| SMILES | COC(=O)CCCC=CC[C@@]1(C(C)(C)C)C(O)CCN1C(=O)O |
| InChI | InChI=1S/C17H29NO5/c1-16(2,3)17(13(19)10-12-18(17)15(21)22)11-8-6-5-7-9-14(20)23-4/h6,8,13,19H,5,7,9-12H2,1-4H3,(H,21,22)/t13?,17-/m0/s1 |
| InChIKey | MMKLOKFXJJWRGP-RUINGEJQSA-N |
| XLogP | 2.81 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|