C11H7Cl2NOS2 — CID 57029068
5-[1-(3,4-dichlorophenyl)ethylidene]-4-sulfanylidene-1,3-thiazolidin-2-one (PubChem CID 57029068) has the molecular formula C11H7Cl2NOS2 and a molecular weight of 304.22 g/mol. Its IUPAC name is 5-[1-(3,4-dichlorophenyl)ethylidene]-4-sulfanylidene-1,3-thiazolidin-2-one.
| Compound Name | 5-[1-(3,4-dichlorophenyl)ethylidene]-4-sulfanylidene-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 57029068 |
| Molecular Formula | C11H7Cl2NOS2 |
| Molecular Weight | 304.22 g/mol |
| Exact Mass | 302.93 |
| IUPAC Name | 5-[1-(3,4-dichlorophenyl)ethylidene]-4-sulfanylidene-1,3-thiazolidin-2-one |
| SMILES | CC(=C1SC(=O)NC1=S)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H7Cl2NOS2/c1-5(9-10(16)14-11(15)17-9)6-2-3-7(12)8(13)4-6/h2-4H,1H3,(H,14,15,16) |
| InChIKey | HHJXZPWUZIHZGB-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.22 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|