C27H36ClNO2 — CID 57031503
2-(4-chlorophenyl)-1-[5-[4-[(dipropylamino)methyl]phenyl]-2-hydroxycyclohexyl]ethanone (PubChem CID 57031503) has the molecular formula C27H36ClNO2 and a molecular weight of 442.04 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-1-[5-[4-[(dipropylamino)methyl]phenyl]-2-hydroxycyclohexyl]ethanone.
| Compound Name | 2-(4-chlorophenyl)-1-[5-[4-[(dipropylamino)methyl]phenyl]-2-hydroxycyclohexyl]ethanone |
|---|---|
| PubChem CID | 57031503 |
| Molecular Formula | C27H36ClNO2 |
| Molecular Weight | 442.04 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | 2-(4-chlorophenyl)-1-[5-[4-[(dipropylamino)methyl]phenyl]-2-hydroxycyclohexyl]ethanone |
| SMILES | CCCN(CCC)Cc1ccc(C2CCC(O)C(C(=O)Cc3ccc(Cl)cc3)C2)cc1 |
| InChI | InChI=1S/C27H36ClNO2/c1-3-15-29(16-4-2)19-21-5-9-22(10-6-21)23-11-14-26(30)25(18-23)27(31)17-20-7-12-24(28)13-8-20/h5-10,12-13,23,25-26,30H,3-4,11,14-19H2,1-2H3 |
| InChIKey | QAOXMYAJBWNSFF-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.04 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |