C23H28FNO2 — CID 57100637
1-[5-[4-[(dimethylamino)methyl]phenyl]-2-hydroxycyclohexyl]-2-(4-fluorophenyl)ethanone (PubChem CID 57100637) has the molecular formula C23H28FNO2 and a molecular weight of 369.48 g/mol. Its IUPAC name is 1-[5-[4-[(dimethylamino)methyl]phenyl]-2-hydroxycyclohexyl]-2-(4-fluorophenyl)ethanone.
| Compound Name | 1-[5-[4-[(dimethylamino)methyl]phenyl]-2-hydroxycyclohexyl]-2-(4-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 57100637 |
| Molecular Formula | C23H28FNO2 |
| Molecular Weight | 369.48 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | 1-[5-[4-[(dimethylamino)methyl]phenyl]-2-hydroxycyclohexyl]-2-(4-fluorophenyl)ethanone |
| SMILES | CN(C)Cc1ccc(C2CCC(O)C(C(=O)Cc3ccc(F)cc3)C2)cc1 |
| InChI | InChI=1S/C23H28FNO2/c1-25(2)15-17-3-7-18(8-4-17)19-9-12-22(26)21(14-19)23(27)13-16-5-10-20(24)11-6-16/h3-8,10-11,19,21-22,26H,9,12-15H2,1-2H3 |
| InChIKey | QOTANLSLRQAIOQ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.48 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |