C21H29NO2 — CID 56975416
1-[5-[4-[[bis(prop-2-enyl)amino]methyl]phenyl]-2-hydroxycyclohexyl]ethanone (PubChem CID 56975416) has the molecular formula C21H29NO2 and a molecular weight of 327.47 g/mol. Its IUPAC name is 1-[5-[4-[[bis(prop-2-enyl)amino]methyl]phenyl]-2-hydroxycyclohexyl]ethanone.
| Compound Name | 1-[5-[4-[[bis(prop-2-enyl)amino]methyl]phenyl]-2-hydroxycyclohexyl]ethanone |
|---|---|
| PubChem CID | 56975416 |
| Molecular Formula | C21H29NO2 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | 1-[5-[4-[[bis(prop-2-enyl)amino]methyl]phenyl]-2-hydroxycyclohexyl]ethanone |
| SMILES | C=CCN(CC=C)Cc1ccc(C2CCC(O)C(C(C)=O)C2)cc1 |
| InChI | InChI=1S/C21H29NO2/c1-4-12-22(13-5-2)15-17-6-8-18(9-7-17)19-10-11-21(24)20(14-19)16(3)23/h4-9,19-21,24H,1-2,10-15H2,3H3 |
| InChIKey | DJYRVFKPNGDSCG-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|