C23H31NO2 — CID 134904473
(2S,3S,5S)-5-(dibenzylamino)-2-hydroxy-3,6-dimethylheptan-4-one (PubChem CID 134904473) has the molecular formula C23H31NO2 and a molecular weight of 353.51 g/mol. Its IUPAC name is (2S,3S,5S)-5-(dibenzylamino)-2-hydroxy-3,6-dimethylheptan-4-one.
| Compound Name | (2S,3S,5S)-5-(dibenzylamino)-2-hydroxy-3,6-dimethylheptan-4-one |
|---|---|
| PubChem CID | 134904473 |
| Molecular Formula | C23H31NO2 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.24 |
| IUPAC Name | (2S,3S,5S)-5-(dibenzylamino)-2-hydroxy-3,6-dimethylheptan-4-one |
| SMILES | CC(C)[C@@H](C(=O)[C@@H](C)[C@H](C)O)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C23H31NO2/c1-17(2)22(23(26)18(3)19(4)25)24(15-20-11-7-5-8-12-20)16-21-13-9-6-10-14-21/h5-14,17-19,22,25H,15-16H2,1-4H3/t18-,19-,22-/m0/s1 |
| InChIKey | LICJWTCVIGQUJG-IPJJNNNSSA-N |
| XLogP | 4.30 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |