C24H28FNO2 — CID 57209308
1-[5-[4-[(dimethylamino)methyl]phenyl]-2-hydroxycyclohexyl]-3-(4-fluorophenyl)prop-2-en-1-one (PubChem CID 57209308) has the molecular formula C24H28FNO2 and a molecular weight of 381.49 g/mol. Its IUPAC name is 1-[5-[4-[(dimethylamino)methyl]phenyl]-2-hydroxycyclohexyl]-3-(4-fluorophenyl)prop-2-en-1-one.
| Compound Name | 1-[5-[4-[(dimethylamino)methyl]phenyl]-2-hydroxycyclohexyl]-3-(4-fluorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 57209308 |
| Molecular Formula | C24H28FNO2 |
| Molecular Weight | 381.49 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | 1-[5-[4-[(dimethylamino)methyl]phenyl]-2-hydroxycyclohexyl]-3-(4-fluorophenyl)prop-2-en-1-one |
| SMILES | CN(C)Cc1ccc(C2CCC(O)C(C(=O)C=Cc3ccc(F)cc3)C2)cc1 |
| InChI | InChI=1S/C24H28FNO2/c1-26(2)16-18-3-8-19(9-4-18)20-10-14-24(28)22(15-20)23(27)13-7-17-5-11-21(25)12-6-17/h3-9,11-13,20,22,24,28H,10,14-16H2,1-2H3 |
| InChIKey | MZLZJABHIMUJAT-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.49 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|