C16H16N2O4 — CID 57032342
[2-(methoxycarbonylamino)phenyl]-(3-methylphenyl)carbamic acid (PubChem CID 57032342) has the molecular formula C16H16N2O4 and a molecular weight of 300.31 g/mol. Its IUPAC name is [2-(methoxycarbonylamino)phenyl]-(3-methylphenyl)carbamic acid.
| Compound Name | [2-(methoxycarbonylamino)phenyl]-(3-methylphenyl)carbamic acid |
|---|---|
| PubChem CID | 57032342 |
| Molecular Formula | C16H16N2O4 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | [2-(methoxycarbonylamino)phenyl]-(3-methylphenyl)carbamic acid |
| SMILES | COC(=O)Nc1ccccc1N(C(=O)O)c1cccc(C)c1 |
| InChI | InChI=1S/C16H16N2O4/c1-11-6-5-7-12(10-11)18(16(20)21)14-9-4-3-8-13(14)17-15(19)22-2/h3-10H,1-2H3,(H,17,19)(H,20,21) |
| InChIKey | XSSNXGHCJCKYLS-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |