C28H44O2 — CID 57032463
(3S,5R,9R,10R,13R,17S)-4,4,10,13-tetramethyl-17-[(1S)-1-(3-methylbut-2-enoxy)ethyl]-1,2,3,5,9,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 57032463) has the molecular formula C28H44O2 and a molecular weight of 412.66 g/mol. Its IUPAC name is (3S,5R,9R,10R,13R,17S)-4,4,10,13-tetramethyl-17-[(1S)-1-(3-methylbut-2-enoxy)ethyl]-1,2,3,5,9,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,5R,9R,10R,13R,17S)-4,4,10,13-tetramethyl-17-[(1S)-1-(3-methylbut-2-enoxy)ethyl]-1,2,3,5,9,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 57032463 |
| Molecular Formula | C28H44O2 |
| Molecular Weight | 412.66 g/mol |
| Exact Mass | 412.33 |
| IUPAC Name | (3S,5R,9R,10R,13R,17S)-4,4,10,13-tetramethyl-17-[(1S)-1-(3-methylbut-2-enoxy)ethyl]-1,2,3,5,9,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | CC(C)=CCO[C@@H](C)[C@H]1CCC2=C3C=C[C@H]4C(C)(C)[C@@H](O)CC[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C28H44O2/c1-18(2)14-17-30-19(3)21-9-10-22-20-8-11-24-26(4,5)25(29)13-16-28(24,7)23(20)12-15-27(21,22)6/h8,11,14,19,21,23-25,29H,9-10,12-13,15-17H2,1-7H3/t19-,21+,23-,24-,25-,27+,28+/m0/s1 |
| InChIKey | WIJWCGZSUHVSEI-CXOWISSASA-N |
| XLogP | 6.85 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.66 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|