C21H40O2Si — CID 57037503
(4R)-4-[(1R,3aS,4R,7aS)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]pent-2-en-1-ol (PubChem CID 57037503) has the molecular formula C21H40O2Si and a molecular weight of 352.64 g/mol. Its IUPAC name is (4R)-4-[(1R,3aS,4R,7aS)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]pent-2-en-1-ol.
| Compound Name | (4R)-4-[(1R,3aS,4R,7aS)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]pent-2-en-1-ol |
|---|---|
| PubChem CID | 57037503 |
| Molecular Formula | C21H40O2Si |
| Molecular Weight | 352.64 g/mol |
| Exact Mass | 352.28 |
| IUPAC Name | (4R)-4-[(1R,3aS,4R,7aS)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]pent-2-en-1-ol |
| SMILES | C[C@H](C=CCO)[C@H]1CC[C@@H]2[C@H](O[Si](C)(C)C(C)(C)C)CCC[C@@]12C |
| InChI | InChI=1S/C21H40O2Si/c1-16(10-9-15-22)17-12-13-18-19(11-8-14-21(17,18)5)23-24(6,7)20(2,3)4/h9-10,16-19,22H,8,11-15H2,1-7H3/t16-,17-,18-,19-,21+/m1/s1 |
| InChIKey | IJNXDCGAUYHYLX-FKAKKMJLSA-N |
| XLogP | 5.78 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.64 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|