C20H19N — CID 57037582
1-methyl-20-azapentacyclo[11.6.1.02,11.05,10.014,19]icosa-2(11),3,6,9,13(20),16,18-heptaene (PubChem CID 57037582) has the molecular formula C20H19N and a molecular weight of 273.38 g/mol. Its IUPAC name is 1-methyl-20-azapentacyclo[11.6.1.02,11.05,10.014,19]icosa-2(11),3,6,9,13(20),16,18-heptaene.
| Compound Name | 1-methyl-20-azapentacyclo[11.6.1.02,11.05,10.014,19]icosa-2(11),3,6,9,13(20),16,18-heptaene |
|---|---|
| PubChem CID | 57037582 |
| Molecular Formula | C20H19N |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 1-methyl-20-azapentacyclo[11.6.1.02,11.05,10.014,19]icosa-2(11),3,6,9,13(20),16,18-heptaene |
| SMILES | CC12N=C(CC3=C1C=CC1C=CCC=C31)C1CC=CC=C12 |
| InChI | InChI=1S/C20H19N/c1-20-17-9-5-4-8-15(17)19(21-20)12-16-14-7-3-2-6-13(14)10-11-18(16)20/h2,4-7,9-11,13,15H,3,8,12H2,1H3 |
| InChIKey | WWOVLVMRULROSY-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|