C17H18BrN3O2 — CID 57042937
1-N-benzyl-4-bromo-2-nitro-5,6,7,8-tetrahydronaphthalene-1,7-diamine (PubChem CID 57042937) has the molecular formula C17H18BrN3O2 and a molecular weight of 376.25 g/mol. Its IUPAC name is 1-N-benzyl-4-bromo-2-nitro-5,6,7,8-tetrahydronaphthalene-1,7-diamine.
| Compound Name | 1-N-benzyl-4-bromo-2-nitro-5,6,7,8-tetrahydronaphthalene-1,7-diamine |
|---|---|
| PubChem CID | 57042937 |
| Molecular Formula | C17H18BrN3O2 |
| Molecular Weight | 376.25 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | 1-N-benzyl-4-bromo-2-nitro-5,6,7,8-tetrahydronaphthalene-1,7-diamine |
| SMILES | NC1CCc2c(Br)cc([N+](=O)[O-])c(NCc3ccccc3)c2C1 |
| InChI | InChI=1S/C17H18BrN3O2/c18-15-9-16(21(22)23)17(14-8-12(19)6-7-13(14)15)20-10-11-4-2-1-3-5-11/h1-5,9,12,20H,6-8,10,19H2 |
| InChIKey | OOWYTSRXTRSCOG-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.25 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|