About [4-[1-[4-(2-chloroacetyl)oxy-3-fluorophenoxy]ethoxy]-2-fluorophenyl] 2-chloroacetate
[4-[1-[4-(2-chloroacetyl)oxy-3-fluorophenoxy]ethoxy]-2-fluorophenyl] 2-chloroacetate (PubChem CID 57043270) has the molecular formula C18H14Cl2F2O6
and a molecular weight of 435.21 g/mol. Its IUPAC name is [4-[1-[4-(2-chloroacetyl)oxy-3-fluorophenoxy]ethoxy]-2-fluorophenyl] 2-chloroacetate.
Molecular Properties
| Compound Name | [4-[1-[4-(2-chloroacetyl)oxy-3-fluorophenoxy]ethoxy]-2-fluorophenyl] 2-chloroacetate |
| PubChem CID | 57043270 |
| Molecular Formula | C18H14Cl2F2O6 |
| Molecular Weight | 435.21 g/mol |
| Exact Mass | 434.01 |
| IUPAC Name | [4-[1-[4-(2-chloroacetyl)oxy-3-fluorophenoxy]ethoxy]-2-fluorophenyl] 2-chloroacetate |
| SMILES | CC(Oc1ccc(OC(=O)CCl)c(F)c1)Oc1ccc(OC(=O)CCl)c(F)c1 |
| InChI | InChI=1S/C18H14Cl2F2O6/c1-10(25-11-2-4-15(13(21)6-11)27-17(23)8-19)26-12-3-5-16(14(22)7-12)28-18(24)9-20/h2-7,10H,8-9H2,1H3 |
| InChIKey | IXIXAMHEQCIWCZ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 435.21 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[1-[4-(2-chloroacetyl)oxy-3-fluorophenoxy]ethoxy]-2-fluorophenyl] 2-chloroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[1-[4-(2-chloroacetyl)oxy-3-fluorophenoxy]ethoxy]-2-fluorophenyl] 2-chloroacetate?
The IUPAC name of [4-[1-[4-(2-chloroacetyl)oxy-3-fluorophenoxy]ethoxy]-2-fluorophenyl] 2-chloroacetate (CID 57043270) is [4-[1-[4-(2-chloroacetyl)oxy-3-fluorophenoxy]ethoxy]-2-fluorophenyl] 2-chloroacetate.
What is the SMILES notation for [4-[1-[4-(2-chloroacetyl)oxy-3-fluorophenoxy]ethoxy]-2-fluorophenyl] 2-chloroacetate?
The canonical SMILES for [4-[1-[4-(2-chloroacetyl)oxy-3-fluorophenoxy]ethoxy]-2-fluorophenyl] 2-chloroacetate is CC(Oc1ccc(OC(=O)CCl)c(F)c1)Oc1ccc(OC(=O)CCl)c(F)c1.
What is the InChIKey of [4-[1-[4-(2-chloroacetyl)oxy-3-fluorophenoxy]ethoxy]-2-fluorophenyl] 2-chloroacetate?
The InChIKey is IXIXAMHEQCIWCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14Cl2F2O6/c1-10(25-11-2-4-15(13(21)6-11)27-17(23)8-19)26-12-3-5-16(14(22)7-12)28-18(24)9-20/h2-7,10H,8-9H2,1H3.
What are the key properties of [4-[1-[4-(2-chloroacetyl)oxy-3-fluorophenoxy]ethoxy]-2-fluorophenyl] 2-chloroacetate?
[4-[1-[4-(2-chloroacetyl)oxy-3-fluorophenoxy]ethoxy]-2-fluorophenyl] 2-chloroacetate has a molecular weight of 435.21 g/mol, XLogP of 4.06, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[1-[4-(2-chloroacetyl)oxy-3-fluorophenoxy]ethoxy]-2-fluorophenyl] 2-chloroacetate is sourced from PubChem (CID 57043270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).