C11H12N2 — CID 57043520
3,4,4a,5-tetrahydro-2H-cyclopenta[f]quinoxaline (PubChem CID 57043520) has the molecular formula C11H12N2 and a molecular weight of 172.23 g/mol. Its IUPAC name is 3,4,4a,5-tetrahydro-2H-cyclopenta[f]quinoxaline.
| Compound Name | 3,4,4a,5-tetrahydro-2H-cyclopenta[f]quinoxaline |
|---|---|
| PubChem CID | 57043520 |
| Molecular Formula | C11H12N2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | 3,4,4a,5-tetrahydro-2H-cyclopenta[f]quinoxaline |
| SMILES | C1=CC2=CCC3NCCN=C3C2=C1 |
| InChI | InChI=1S/C11H12N2/c1-2-8-4-5-10-11(9(8)3-1)13-7-6-12-10/h1-4,10,12H,5-7H2 |
| InChIKey | HRILULNKJZEOCX-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |