C22H41O16P — CID 57045385
[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-5-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-2-(9-methoxy-9-oxononoxy)oxan-3-yl]oxan-3-yl]phosphonic acid (PubChem CID 57045385) has the molecular formula C22H41O16P and a molecular weight of 592.53 g/mol. Its IUPAC name is [(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-5-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-2-(9-methoxy-9-oxononoxy)oxan-3-yl]oxan-3-yl]phosphonic acid.
| Compound Name | [(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-5-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-2-(9-methoxy-9-oxononoxy)oxan-3-yl]oxan-3-yl]phosphonic acid |
|---|---|
| PubChem CID | 57045385 |
| Molecular Formula | C22H41O16P |
| Molecular Weight | 592.53 g/mol |
| Exact Mass | 592.21 |
| IUPAC Name | [(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-5-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-2-(9-methoxy-9-oxononoxy)oxan-3-yl]oxan-3-yl]phosphonic acid |
| SMILES | COC(=O)CCCCCCCCO[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@]1(O)[C@@]1(O)[C@@H](CO)OC[C@@](O)(P(=O)(O)O)[C@H]1O |
| InChI | InChI=1S/C22H41O16P/c1-35-15(25)8-6-4-2-3-5-7-9-36-19-22(31,17(27)16(26)13(10-23)38-19)21(30)14(11-24)37-12-20(29,18(21)28)39(32,33)34/h13-14,16-19,23-24,26-31H,2-12H2,1H3,(H2,32,33,34)/t13-,14-,16-,17+,18-,19+,20-,21-,22-/m1/s1 |
| InChIKey | YUDBVRLPDFQODC-NCHINKSGSA-N |
| XLogP | -3.57 |
| TPSA | 273.36 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.53 |
| LogP ≤ 5 | -3.57 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|