About CID 57047461
CID 57047461 (PubChem CID 57047461) has the molecular formula C11H11ClF3Si
and a molecular weight of 263.74 g/mol.
Molecular Properties
| Compound Name | CID 57047461 |
| PubChem CID | 57047461 |
| Molecular Formula | C11H11ClF3Si |
| Molecular Weight | 263.74 g/mol |
| Exact Mass | 263.03 |
| IUPAC Name | — |
| SMILES | C=C[Si](C)C(Cl)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C11H11ClF3Si/c1-3-16(2)10(12)8-6-4-5-7-9(8)11(13,14)15/h3-7,10H,1H2,2H3 |
| InChIKey | WRZTVAFHJMVOAZ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.74 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 57047461 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 57047461?
The IUPAC name of CID 57047461 (CID 57047461) is not available.
What is the SMILES notation for CID 57047461?
The canonical SMILES for CID 57047461 is C=C[Si](C)C(Cl)c1ccccc1C(F)(F)F.
What is the InChIKey of CID 57047461?
The InChIKey is WRZTVAFHJMVOAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11ClF3Si/c1-3-16(2)10(12)8-6-4-5-7-9(8)11(13,14)15/h3-7,10H,1H2,2H3.
What are the key properties of CID 57047461?
CID 57047461 has a molecular weight of 263.74 g/mol, XLogP of 4.37, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 57047461 is sourced from PubChem (CID 57047461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).