C17H32O — CID 57047859
6-butan-2-yl-1,1,4a-trimethyl-2,3,4,5,6,7,8,8a-octahydronaphthalen-2-ol (PubChem CID 57047859) has the molecular formula C17H32O and a molecular weight of 252.44 g/mol. Its IUPAC name is 6-butan-2-yl-1,1,4a-trimethyl-2,3,4,5,6,7,8,8a-octahydronaphthalen-2-ol.
| Compound Name | 6-butan-2-yl-1,1,4a-trimethyl-2,3,4,5,6,7,8,8a-octahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 57047859 |
| Molecular Formula | C17H32O |
| Molecular Weight | 252.44 g/mol |
| Exact Mass | 252.25 |
| IUPAC Name | 6-butan-2-yl-1,1,4a-trimethyl-2,3,4,5,6,7,8,8a-octahydronaphthalen-2-ol |
| SMILES | CCC(C)C1CCC2C(C)(CCC(O)C2(C)C)C1 |
| InChI | InChI=1S/C17H32O/c1-6-12(2)13-7-8-14-16(3,4)15(18)9-10-17(14,5)11-13/h12-15,18H,6-11H2,1-5H3 |
| InChIKey | IAQITJGLGUBUJI-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.44 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |