About (2-methyl-3-nitrophenyl) 3-phenylpropanoate
(2-methyl-3-nitrophenyl) 3-phenylpropanoate (PubChem CID 570503) has the molecular formula C16H15NO4
and a molecular weight of 285.30 g/mol. Its IUPAC name is (2-methyl-3-nitrophenyl) 3-phenylpropanoate.
Molecular Properties
| Compound Name | (2-methyl-3-nitrophenyl) 3-phenylpropanoate |
| PubChem CID | 570503 |
| Molecular Formula | C16H15NO4 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | (2-methyl-3-nitrophenyl) 3-phenylpropanoate |
| SMILES | Cc1c(OC(=O)CCc2ccccc2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H15NO4/c1-12-14(17(19)20)8-5-9-15(12)21-16(18)11-10-13-6-3-2-4-7-13/h2-9H,10-11H2,1H3 |
| InChIKey | ZBXMVDCLYMAGFD-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-methyl-3-nitrophenyl) 3-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyl-3-nitrophenyl) 3-phenylpropanoate?
The IUPAC name of (2-methyl-3-nitrophenyl) 3-phenylpropanoate (CID 570503) is (2-methyl-3-nitrophenyl) 3-phenylpropanoate.
What is the SMILES notation for (2-methyl-3-nitrophenyl) 3-phenylpropanoate?
The canonical SMILES for (2-methyl-3-nitrophenyl) 3-phenylpropanoate is Cc1c(OC(=O)CCc2ccccc2)cccc1[N+](=O)[O-].
What is the InChIKey of (2-methyl-3-nitrophenyl) 3-phenylpropanoate?
The InChIKey is ZBXMVDCLYMAGFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15NO4/c1-12-14(17(19)20)8-5-9-15(12)21-16(18)11-10-13-6-3-2-4-7-13/h2-9H,10-11H2,1H3.
What are the key properties of (2-methyl-3-nitrophenyl) 3-phenylpropanoate?
(2-methyl-3-nitrophenyl) 3-phenylpropanoate has a molecular weight of 285.30 g/mol, XLogP of 3.44, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyl-3-nitrophenyl) 3-phenylpropanoate is sourced from PubChem (CID 570503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).