C36H56N2O2 — CID 57051591
5-[2-(5-formyl-3,4-dihexyl-1H-pyrrol-2-yl)ethynyl]-3,4-dihexyl-1H-pyrrole-2-carbaldehyde (PubChem CID 57051591) has the molecular formula C36H56N2O2 and a molecular weight of 548.86 g/mol. Its IUPAC name is 5-[2-(5-formyl-3,4-dihexyl-1H-pyrrol-2-yl)ethynyl]-3,4-dihexyl-1H-pyrrole-2-carbaldehyde.
| Compound Name | 5-[2-(5-formyl-3,4-dihexyl-1H-pyrrol-2-yl)ethynyl]-3,4-dihexyl-1H-pyrrole-2-carbaldehyde |
|---|---|
| PubChem CID | 57051591 |
| Molecular Formula | C36H56N2O2 |
| Molecular Weight | 548.86 g/mol |
| Exact Mass | 548.43 |
| IUPAC Name | 5-[2-(5-formyl-3,4-dihexyl-1H-pyrrol-2-yl)ethynyl]-3,4-dihexyl-1H-pyrrole-2-carbaldehyde |
| SMILES | CCCCCCc1c(C#Cc2[nH]c(C=O)c(CCCCCC)c2CCCCCC)[nH]c(C=O)c1CCCCCC |
| InChI | InChI=1S/C36H56N2O2/c1-5-9-13-17-21-29-31(23-19-15-11-7-3)35(27-39)37-33(29)25-26-34-30(22-18-14-10-6-2)32(36(28-40)38-34)24-20-16-12-8-4/h27-28,37-38H,5-24H2,1-4H3 |
| InChIKey | QBXDZCHJJCYGQP-UHFFFAOYSA-N |
| XLogP | 9.86 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.86 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|